C13H19N3O2 — CID 162881214
4-(6,7-dihydroxy-1,2,3,4-tetrahydroisoquinolin-1-yl)butanimidamide (PubChem CID 162881214) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is 4-(6,7-dihydroxy-1,2,3,4-tetrahydroisoquinolin-1-yl)butanimidamide.
| Compound Name | 4-(6,7-dihydroxy-1,2,3,4-tetrahydroisoquinolin-1-yl)butanimidamide |
|---|---|
| PubChem CID | 162881214 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 4-(6,7-dihydroxy-1,2,3,4-tetrahydroisoquinolin-1-yl)butanimidamide |
| SMILES | [H]/N=C(\N)CCCC1NCCc2cc(O)c(O)cc21 |
| InChI | InChI=1S/C13H19N3O2/c14-13(15)3-1-2-10-9-7-12(18)11(17)6-8(9)4-5-16-10/h6-7,10,16-18H,1-5H2,(H3,14,15) |
| InChIKey | JYDSKJBPKMQERO-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 102.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|