C15H22N2O3 — CID 21494271
1-(2-morpholin-4-ylethyl)-1,2,3,4-tetrahydroisoquinoline-6,7-diol (PubChem CID 21494271) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 1-(2-morpholin-4-ylethyl)-1,2,3,4-tetrahydroisoquinoline-6,7-diol.
| Compound Name | 1-(2-morpholin-4-ylethyl)-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
|---|---|
| PubChem CID | 21494271 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 1-(2-morpholin-4-ylethyl)-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
| SMILES | Oc1cc2c(cc1O)C(CCN1CCOCC1)NCC2 |
| InChI | InChI=1S/C15H22N2O3/c18-14-9-11-1-3-16-13(12(11)10-15(14)19)2-4-17-5-7-20-8-6-17/h9-10,13,16,18-19H,1-8H2 |
| InChIKey | LCTQCQLQFJYJDK-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|