C19H23NO6 — CID 90672494
(1R)-1-[(R)-hydroxy-(3,4,5-trimethoxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol (PubChem CID 90672494) has the molecular formula C19H23NO6 and a molecular weight of 361.39 g/mol. Its IUPAC name is (1R)-1-[(R)-hydroxy-(3,4,5-trimethoxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol.
| Compound Name | (1R)-1-[(R)-hydroxy-(3,4,5-trimethoxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
|---|---|
| PubChem CID | 90672494 |
| Molecular Formula | C19H23NO6 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | (1R)-1-[(R)-hydroxy-(3,4,5-trimethoxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
| SMILES | COc1cc([C@@H](O)[C@@H]2NCCc3cc(O)c(O)cc32)cc(OC)c1OC |
| InChI | InChI=1S/C19H23NO6/c1-24-15-7-11(8-16(25-2)19(15)26-3)18(23)17-12-9-14(22)13(21)6-10(12)4-5-20-17/h6-9,17-18,20-23H,4-5H2,1-3H3/t17-,18-/m1/s1 |
| InChIKey | MRHXJYSWOHVYII-QZTJIDSGSA-N |
| XLogP | 2.04 |
| TPSA | 100.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|