C20H25NO3 — CID 3923460
1-(5-tert-butyl-2-methoxyphenyl)-1,2,3,4-tetrahydroisoquinoline-6,7-diol (PubChem CID 3923460) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is 1-(5-tert-butyl-2-methoxyphenyl)-1,2,3,4-tetrahydroisoquinoline-6,7-diol.
| Compound Name | 1-(5-tert-butyl-2-methoxyphenyl)-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
|---|---|
| PubChem CID | 3923460 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 1-(5-tert-butyl-2-methoxyphenyl)-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
| SMILES | COc1ccc(C(C)(C)C)cc1C1NCCc2cc(O)c(O)cc21 |
| InChI | InChI=1S/C20H25NO3/c1-20(2,3)13-5-6-18(24-4)15(10-13)19-14-11-17(23)16(22)9-12(14)7-8-21-19/h5-6,9-11,19,21-23H,7-8H2,1-4H3 |
| InChIKey | FVVSCJAWNREKJE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|