C22H25BrN2O — CID 3973874
6-bromo-1-(5-tert-butyl-2-methoxyphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 3973874) has the molecular formula C22H25BrN2O and a molecular weight of 413.36 g/mol. Its IUPAC name is 6-bromo-1-(5-tert-butyl-2-methoxyphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | 6-bromo-1-(5-tert-butyl-2-methoxyphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 3973874 |
| Molecular Formula | C22H25BrN2O |
| Molecular Weight | 413.36 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 6-bromo-1-(5-tert-butyl-2-methoxyphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | COc1ccc(C(C)(C)C)cc1C1NCCc2c1[nH]c1ccc(Br)cc21 |
| InChI | InChI=1S/C22H25BrN2O/c1-22(2,3)13-5-8-19(26-4)17(11-13)20-21-15(9-10-24-20)16-12-14(23)6-7-18(16)25-21/h5-8,11-12,20,24-25H,9-10H2,1-4H3 |
| InChIKey | CGTDJWRCZYXQFQ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.36 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|