C17H14BrIN2 — CID 3924530
6-bromo-1-(3-iodophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 3924530) has the molecular formula C17H14BrIN2 and a molecular weight of 453.12 g/mol. Its IUPAC name is 6-bromo-1-(3-iodophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | 6-bromo-1-(3-iodophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 3924530 |
| Molecular Formula | C17H14BrIN2 |
| Molecular Weight | 453.12 g/mol |
| Exact Mass | 451.94 |
| IUPAC Name | 6-bromo-1-(3-iodophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | Brc1ccc2[nH]c3c(c2c1)CCNC3c1cccc(I)c1 |
| InChI | InChI=1S/C17H14BrIN2/c18-11-4-5-15-14(9-11)13-6-7-20-16(17(13)21-15)10-2-1-3-12(19)8-10/h1-5,8-9,16,20-21H,6-7H2 |
| InChIKey | NDSDQSYEMFYWHW-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.12 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|