C17H13BrCl2N2 — CID 4678632
6-bromo-1-(2,5-dichlorophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 4678632) has the molecular formula C17H13BrCl2N2 and a molecular weight of 396.12 g/mol. Its IUPAC name is 6-bromo-1-(2,5-dichlorophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | 6-bromo-1-(2,5-dichlorophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 4678632 |
| Molecular Formula | C17H13BrCl2N2 |
| Molecular Weight | 396.12 g/mol |
| Exact Mass | 393.96 |
| IUPAC Name | 6-bromo-1-(2,5-dichlorophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | Clc1ccc(Cl)c(C2NCCc3c2[nH]c2ccc(Br)cc32)c1 |
| InChI | InChI=1S/C17H13BrCl2N2/c18-9-1-4-15-12(7-9)11-5-6-21-16(17(11)22-15)13-8-10(19)2-3-14(13)20/h1-4,7-8,16,21-22H,5-6H2 |
| InChIKey | HFHRTXXXHAMYKO-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.12 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|