C18H17BrN2O — CID 143312751
2-(6-bromo-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)-4-methylphenol (PubChem CID 143312751) has the molecular formula C18H17BrN2O and a molecular weight of 357.25 g/mol. Its IUPAC name is 2-(6-bromo-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)-4-methylphenol.
| Compound Name | 2-(6-bromo-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)-4-methylphenol |
|---|---|
| PubChem CID | 143312751 |
| Molecular Formula | C18H17BrN2O |
| Molecular Weight | 357.25 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 2-(6-bromo-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)-4-methylphenol |
| SMILES | Cc1ccc(O)c(C2NCCc3c2[nH]c2ccc(Br)cc32)c1 |
| InChI | InChI=1S/C18H17BrN2O/c1-10-2-5-16(22)14(8-10)17-18-12(6-7-20-17)13-9-11(19)3-4-15(13)21-18/h2-5,8-9,17,20-22H,6-7H2,1H3 |
| InChIKey | BDFAYWPXSYFFCU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.25 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|