C18H16Br2N2O — CID 4260691
1-(2,5-dibromophenyl)-6-methoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 4260691) has the molecular formula C18H16Br2N2O and a molecular weight of 436.15 g/mol. Its IUPAC name is 1-(2,5-dibromophenyl)-6-methoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | 1-(2,5-dibromophenyl)-6-methoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 4260691 |
| Molecular Formula | C18H16Br2N2O |
| Molecular Weight | 436.15 g/mol |
| Exact Mass | 433.96 |
| IUPAC Name | 1-(2,5-dibromophenyl)-6-methoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCNC3c1cc(Br)ccc1Br |
| InChI | InChI=1S/C18H16Br2N2O/c1-23-11-3-5-16-13(9-11)12-6-7-21-17(18(12)22-16)14-8-10(19)2-4-15(14)20/h2-5,8-9,17,21-22H,6-7H2,1H3 |
| InChIKey | FHVIDTZFEOVAQY-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.15 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|