C26H25BrN2O3 — CID 1426984
(1S)-1-[3-[(4-bromophenoxy)methyl]-4-methoxyphenyl]-6-methoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 1426984) has the molecular formula C26H25BrN2O3 and a molecular weight of 493.40 g/mol. Its IUPAC name is (1S)-1-[3-[(4-bromophenoxy)methyl]-4-methoxyphenyl]-6-methoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | (1S)-1-[3-[(4-bromophenoxy)methyl]-4-methoxyphenyl]-6-methoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 1426984 |
| Molecular Formula | C26H25BrN2O3 |
| Molecular Weight | 493.40 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | (1S)-1-[3-[(4-bromophenoxy)methyl]-4-methoxyphenyl]-6-methoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN[C@H]3c1ccc(OC)c(COc2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C26H25BrN2O3/c1-30-20-8-9-23-22(14-20)21-11-12-28-25(26(21)29-23)16-3-10-24(31-2)17(13-16)15-32-19-6-4-18(27)5-7-19/h3-10,13-14,25,28-29H,11-12,15H2,1-2H3/t25-/m0/s1 |
| InChIKey | XWXIBZTZTSLCSL-VWLOTQADSA-N |
| XLogP | 5.76 |
| TPSA | 55.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.40 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|