C32H27Br3N2O3 — CID 97046209
(1S)-1-[4-methoxy-3-[(2,4,6-tribromophenoxy)methyl]phenyl]-6-phenylmethoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 97046209) has the molecular formula C32H27Br3N2O3 and a molecular weight of 727.29 g/mol. Its IUPAC name is (1S)-1-[4-methoxy-3-[(2,4,6-tribromophenoxy)methyl]phenyl]-6-phenylmethoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | (1S)-1-[4-methoxy-3-[(2,4,6-tribromophenoxy)methyl]phenyl]-6-phenylmethoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 97046209 |
| Molecular Formula | C32H27Br3N2O3 |
| Molecular Weight | 727.29 g/mol |
| Exact Mass | 723.96 |
| IUPAC Name | (1S)-1-[4-methoxy-3-[(2,4,6-tribromophenoxy)methyl]phenyl]-6-phenylmethoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | COc1ccc([C@@H]2NCCc3c2[nH]c2ccc(OCc4ccccc4)cc32)cc1COc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C32H27Br3N2O3/c1-38-29-10-7-20(13-21(29)18-40-32-26(34)14-22(33)15-27(32)35)30-31-24(11-12-36-30)25-16-23(8-9-28(25)37-31)39-17-19-5-3-2-4-6-19/h2-10,13-16,30,36-37H,11-12,17-18H2,1H3/t30-/m0/s1 |
| InChIKey | WSLYRMOORJFTQF-PMERELPUSA-N |
| XLogP | 8.86 |
| TPSA | 55.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.29 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|