C27H27ClN2O3 — CID 3835682
1-[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]-6-methoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 3835682) has the molecular formula C27H27ClN2O3 and a molecular weight of 462.98 g/mol. Its IUPAC name is 1-[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]-6-methoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | 1-[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]-6-methoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 3835682 |
| Molecular Formula | C27H27ClN2O3 |
| Molecular Weight | 462.98 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 1-[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]-6-methoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | CCOc1cc(C2NCCc3c2[nH]c2ccc(OC)cc32)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C27H27ClN2O3/c1-3-32-25-14-17(8-11-24(25)33-16-18-6-4-5-7-22(18)28)26-27-20(12-13-29-26)21-15-19(31-2)9-10-23(21)30-27/h4-11,14-15,26,29-30H,3,12-13,16H2,1-2H3 |
| InChIKey | HXGLMENZPYKXFP-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 55.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.98 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|