C26H26ClN2O2+ — CID 1427165
(1R)-1-[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium (PubChem CID 1427165) has the molecular formula C26H26ClN2O2+ and a molecular weight of 433.96 g/mol. Its IUPAC name is (1R)-1-[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium.
| Compound Name | (1R)-1-[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium |
|---|---|
| PubChem CID | 1427165 |
| Molecular Formula | C26H26ClN2O2+ |
| Molecular Weight | 433.96 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | (1R)-1-[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium |
| SMILES | CCOc1cc([C@H]2[NH2+]CCc3c2[nH]c2ccccc32)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C26H25ClN2O2/c1-2-30-24-15-17(11-12-23(24)31-16-18-7-3-5-9-21(18)27)25-26-20(13-14-28-25)19-8-4-6-10-22(19)29-26/h3-12,15,25,28-29H,2,13-14,16H2,1H3/p+1/t25-/m1/s1 |
| InChIKey | RXXKBFWBKYKLPJ-RUZDIDTESA-O |
| XLogP | 5.01 |
| TPSA | 50.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.96 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|