C28H29ClN2O4 — CID 44658564
1-[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium acetate (PubChem CID 44658564) has the molecular formula C28H29ClN2O4 and a molecular weight of 493.00 g/mol. Its IUPAC name is 1-[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium acetate.
| Compound Name | 1-[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium acetate |
|---|---|
| PubChem CID | 44658564 |
| Molecular Formula | C28H29ClN2O4 |
| Molecular Weight | 493.00 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 1-[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium acetate |
| SMILES | CC(=O)[O-].CCOc1cc(C2[NH2+]CCc3c2[nH]c2ccccc32)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C26H25ClN2O2.C2H4O2/c1-2-30-24-15-17(11-12-23(24)31-16-18-7-3-5-9-21(18)27)25-26-20(13-14-28-25)19-8-4-6-10-22(19)29-26;1-2(3)4/h3-12,15,25,28-29H,2,13-14,16H2,1H3;1H3,(H,3,4) |
| InChIKey | RIHIMVXABCRJNQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 90.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.00 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|