C32H30N3O5+ — CID 3290270
1-[4-methoxy-3-[(4-nitrophenoxy)methyl]phenyl]-6-phenylmethoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium (PubChem CID 3290270) has the molecular formula C32H30N3O5+ and a molecular weight of 536.61 g/mol. Its IUPAC name is 1-[4-methoxy-3-[(4-nitrophenoxy)methyl]phenyl]-6-phenylmethoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium.
| Compound Name | 1-[4-methoxy-3-[(4-nitrophenoxy)methyl]phenyl]-6-phenylmethoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium |
|---|---|
| PubChem CID | 3290270 |
| Molecular Formula | C32H30N3O5+ |
| Molecular Weight | 536.61 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | 1-[4-methoxy-3-[(4-nitrophenoxy)methyl]phenyl]-6-phenylmethoxy-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium |
| SMILES | COc1ccc(C2[NH2+]CCc3c2[nH]c2ccc(OCc4ccccc4)cc32)cc1COc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C32H29N3O5/c1-38-30-14-7-22(17-23(30)20-40-25-10-8-24(9-11-25)35(36)37)31-32-27(15-16-33-31)28-18-26(12-13-29(28)34-32)39-19-21-5-3-2-4-6-21/h2-14,17-18,31,33-34H,15-16,19-20H2,1H3/p+1 |
| InChIKey | YRPNPOOXXSDXSV-UHFFFAOYSA-O |
| XLogP | 5.45 |
| TPSA | 103.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.61 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|