C26H26ClN3O5 — CID 90485664
6-methoxy-1-[3-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride (PubChem CID 90485664) has the molecular formula C26H26ClN3O5 and a molecular weight of 495.96 g/mol. Its IUPAC name is 6-methoxy-1-[3-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride.
| Compound Name | 6-methoxy-1-[3-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride |
|---|---|
| PubChem CID | 90485664 |
| Molecular Formula | C26H26ClN3O5 |
| Molecular Weight | 495.96 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | 6-methoxy-1-[3-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCNC3c1ccc(OCc2ccc([N+](=O)[O-])cc2)c(OC)c1.Cl |
| InChI | InChI=1S/C26H25N3O5.ClH/c1-32-19-8-9-22-21(14-19)20-11-12-27-25(26(20)28-22)17-5-10-23(24(13-17)33-2)34-15-16-3-6-18(7-4-16)29(30)31;/h3-10,13-14,25,27-28H,11-12,15H2,1-2H3;1H |
| InChIKey | SOZIJQABXQHBRV-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 98.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.96 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|