C25H22BrFN2O2 — CID 177374540
1-[4-[(3-bromo-4-fluorophenyl)methoxy]-3-methoxyphenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 177374540) has the molecular formula C25H22BrFN2O2 and a molecular weight of 481.37 g/mol. Its IUPAC name is 1-[4-[(3-bromo-4-fluorophenyl)methoxy]-3-methoxyphenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | 1-[4-[(3-bromo-4-fluorophenyl)methoxy]-3-methoxyphenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 177374540 |
| Molecular Formula | C25H22BrFN2O2 |
| Molecular Weight | 481.37 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | 1-[4-[(3-bromo-4-fluorophenyl)methoxy]-3-methoxyphenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | COc1cc(C2NCCc3c2[nH]c2ccccc32)ccc1OCc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C25H22BrFN2O2/c1-30-23-13-16(7-9-22(23)31-14-15-6-8-20(27)19(26)12-15)24-25-18(10-11-28-24)17-4-2-3-5-21(17)29-25/h2-9,12-13,24,28-29H,10-11,14H2,1H3 |
| InChIKey | GCUMNDWPHKJKFB-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 46.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.37 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|