C28H28N2O4 — CID 3847145
ethyl 2-[[2-methoxy-5-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)phenyl]methoxy]benzoate (PubChem CID 3847145) has the molecular formula C28H28N2O4 and a molecular weight of 456.54 g/mol. Its IUPAC name is ethyl 2-[[2-methoxy-5-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)phenyl]methoxy]benzoate.
| Compound Name | ethyl 2-[[2-methoxy-5-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)phenyl]methoxy]benzoate |
|---|---|
| PubChem CID | 3847145 |
| Molecular Formula | C28H28N2O4 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | ethyl 2-[[2-methoxy-5-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)phenyl]methoxy]benzoate |
| SMILES | CCOC(=O)c1ccccc1OCc1cc(C2NCCc3c2[nH]c2ccccc32)ccc1OC |
| InChI | InChI=1S/C28H28N2O4/c1-3-33-28(31)22-9-5-7-11-25(22)34-17-19-16-18(12-13-24(19)32-2)26-27-21(14-15-29-26)20-8-4-6-10-23(20)30-27/h4-13,16,26,29-30H,3,14-15,17H2,1-2H3 |
| InChIKey | MODMKZKNNYYVER-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|