C17H14ClFN2 — CID 3549735
6-chloro-1-(2-fluorophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole (PubChem CID 3549735) has the molecular formula C17H14ClFN2 and a molecular weight of 300.76 g/mol. Its IUPAC name is 6-chloro-1-(2-fluorophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole.
| Compound Name | 6-chloro-1-(2-fluorophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 3549735 |
| Molecular Formula | C17H14ClFN2 |
| Molecular Weight | 300.76 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 6-chloro-1-(2-fluorophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole |
| SMILES | Fc1ccccc1C1NCCc2c1[nH]c1ccc(Cl)cc21 |
| InChI | InChI=1S/C17H14ClFN2/c18-10-5-6-15-13(9-10)11-7-8-20-16(17(11)21-15)12-3-1-2-4-14(12)19/h1-6,9,16,20-21H,7-8H2 |
| InChIKey | LTZBIXNEMCGPQM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.76 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|