C16H16FNO2 — CID 106543736
1-(5-fluoro-2-methoxyphenyl)-1,2,3,4-tetrahydroisoquinolin-7-ol (PubChem CID 106543736) has the molecular formula C16H16FNO2 and a molecular weight of 273.31 g/mol. Its IUPAC name is 1-(5-fluoro-2-methoxyphenyl)-1,2,3,4-tetrahydroisoquinolin-7-ol.
| Compound Name | 1-(5-fluoro-2-methoxyphenyl)-1,2,3,4-tetrahydroisoquinolin-7-ol |
|---|---|
| PubChem CID | 106543736 |
| Molecular Formula | C16H16FNO2 |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 1-(5-fluoro-2-methoxyphenyl)-1,2,3,4-tetrahydroisoquinolin-7-ol |
| SMILES | COc1ccc(F)cc1C1NCCc2ccc(O)cc21 |
| InChI | InChI=1S/C16H16FNO2/c1-20-15-5-3-11(17)8-14(15)16-13-9-12(19)4-2-10(13)6-7-18-16/h2-5,8-9,16,18-19H,6-7H2,1H3 |
| InChIKey | JPRISFXEBGESRV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |