C17H16ClNO5 — CID 52984151
5-(4-chlorophenyl)-2,3,4,5-tetrahydro-1,4-benzoxazepine;oxalic acid (PubChem CID 52984151) has the molecular formula C17H16ClNO5 and a molecular weight of 349.77 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2,3,4,5-tetrahydro-1,4-benzoxazepine;oxalic acid.
| Compound Name | 5-(4-chlorophenyl)-2,3,4,5-tetrahydro-1,4-benzoxazepine;oxalic acid |
|---|---|
| PubChem CID | 52984151 |
| Molecular Formula | C17H16ClNO5 |
| Molecular Weight | 349.77 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 5-(4-chlorophenyl)-2,3,4,5-tetrahydro-1,4-benzoxazepine;oxalic acid |
| SMILES | Clc1ccc(C2NCCOc3ccccc32)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H14ClNO.C2H2O4/c16-12-7-5-11(6-8-12)15-13-3-1-2-4-14(13)18-10-9-17-15;3-1(4)2(5)6/h1-8,15,17H,9-10H2;(H,3,4)(H,5,6) |
| InChIKey | GIARDEJESCTGDF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.77 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|