C14H13BClNO — CID 139692077
4-(4-chlorophenyl)-2-methyl-3,4-dihydro-1,3,2-benzoxazaborinine (PubChem CID 139692077) has the molecular formula C14H13BClNO and a molecular weight of 257.53 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-methyl-3,4-dihydro-1,3,2-benzoxazaborinine.
| Compound Name | 4-(4-chlorophenyl)-2-methyl-3,4-dihydro-1,3,2-benzoxazaborinine |
|---|---|
| PubChem CID | 139692077 |
| Molecular Formula | C14H13BClNO |
| Molecular Weight | 257.53 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 4-(4-chlorophenyl)-2-methyl-3,4-dihydro-1,3,2-benzoxazaborinine |
| SMILES | CB1NC(c2ccc(Cl)cc2)c2ccccc2O1 |
| InChI | InChI=1S/C14H13BClNO/c1-15-17-14(10-6-8-11(16)9-7-10)12-4-2-3-5-13(12)18-15/h2-9,14,17H,1H3 |
| InChIKey | GVHBXDSNWAZBPJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.53 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|