C18H18ClNO — CID 21389652
1-(4-chlorophenyl)-4-propyl-2,4-dihydro-1H-isoquinolin-3-one (PubChem CID 21389652) has the molecular formula C18H18ClNO and a molecular weight of 299.80 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4-propyl-2,4-dihydro-1H-isoquinolin-3-one.
| Compound Name | 1-(4-chlorophenyl)-4-propyl-2,4-dihydro-1H-isoquinolin-3-one |
|---|---|
| PubChem CID | 21389652 |
| Molecular Formula | C18H18ClNO |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 1-(4-chlorophenyl)-4-propyl-2,4-dihydro-1H-isoquinolin-3-one |
| SMILES | CCCC1C(=O)NC(c2ccc(Cl)cc2)c2ccccc21 |
| InChI | InChI=1S/C18H18ClNO/c1-2-5-16-14-6-3-4-7-15(14)17(20-18(16)21)12-8-10-13(19)11-9-12/h3-4,6-11,16-17H,2,5H2,1H3,(H,20,21) |
| InChIKey | YHKVJCZEQMWDFC-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |