C14H11ClO2 — CID 102390074
3-(4-chlorophenyl)-2,3-dihydro-1,4-benzodioxine (PubChem CID 102390074) has the molecular formula C14H11ClO2 and a molecular weight of 246.69 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 3-(4-chlorophenyl)-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 102390074 |
| Molecular Formula | C14H11ClO2 |
| Molecular Weight | 246.69 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | 3-(4-chlorophenyl)-2,3-dihydro-1,4-benzodioxine |
| SMILES | Clc1ccc(C2COc3ccccc3O2)cc1 |
| InChI | InChI=1S/C14H11ClO2/c15-11-7-5-10(6-8-11)14-9-16-12-3-1-2-4-13(12)17-14/h1-8,14H,9H2 |
| InChIKey | DMBFJBFUGDFBML-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.69 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |