C14H14N2O — CID 93031696
(1R)-1-pyridin-3-yl-1,2,3,4-tetrahydroisoquinolin-6-ol (PubChem CID 93031696) has the molecular formula C14H14N2O and a molecular weight of 226.28 g/mol. Its IUPAC name is (1R)-1-pyridin-3-yl-1,2,3,4-tetrahydroisoquinolin-6-ol.
| Compound Name | (1R)-1-pyridin-3-yl-1,2,3,4-tetrahydroisoquinolin-6-ol |
|---|---|
| PubChem CID | 93031696 |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | (1R)-1-pyridin-3-yl-1,2,3,4-tetrahydroisoquinolin-6-ol |
| SMILES | Oc1ccc2c(c1)CCN[C@H]2c1cccnc1 |
| InChI | InChI=1S/C14H14N2O/c17-12-3-4-13-10(8-12)5-7-16-14(13)11-2-1-6-15-9-11/h1-4,6,8-9,14,16-17H,5,7H2/t14-/m0/s1 |
| InChIKey | ZOFDCRNANURLMT-AWEZNQCLSA-N |
| XLogP | 2.02 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |