C19H23NO2 — CID 3640554
1-(3-butoxyphenyl)-1,2,3,4-tetrahydroisoquinolin-6-ol (PubChem CID 3640554) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 1-(3-butoxyphenyl)-1,2,3,4-tetrahydroisoquinolin-6-ol.
| Compound Name | 1-(3-butoxyphenyl)-1,2,3,4-tetrahydroisoquinolin-6-ol |
|---|---|
| PubChem CID | 3640554 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 1-(3-butoxyphenyl)-1,2,3,4-tetrahydroisoquinolin-6-ol |
| SMILES | CCCCOc1cccc(C2NCCc3cc(O)ccc32)c1 |
| InChI | InChI=1S/C19H23NO2/c1-2-3-11-22-17-6-4-5-15(13-17)19-18-8-7-16(21)12-14(18)9-10-20-19/h4-8,12-13,19-21H,2-3,9-11H2,1H3 |
| InChIKey | QXHULMQXYHYGIW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|