C23H30N2O3 — CID 4274536
N,N-diethyl-2-[3-(2,3,6,7,8,9-hexahydro-[1,4]dioxino[2,3-g]isoquinolin-6-yl)phenoxy]ethanamine (PubChem CID 4274536) has the molecular formula C23H30N2O3 and a molecular weight of 382.50 g/mol. Its IUPAC name is N,N-diethyl-2-[3-(2,3,6,7,8,9-hexahydro-[1,4]dioxino[2,3-g]isoquinolin-6-yl)phenoxy]ethanamine.
| Compound Name | N,N-diethyl-2-[3-(2,3,6,7,8,9-hexahydro-[1,4]dioxino[2,3-g]isoquinolin-6-yl)phenoxy]ethanamine |
|---|---|
| PubChem CID | 4274536 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | N,N-diethyl-2-[3-(2,3,6,7,8,9-hexahydro-[1,4]dioxino[2,3-g]isoquinolin-6-yl)phenoxy]ethanamine |
| SMILES | CCN(CC)CCOc1cccc(C2NCCc3cc4c(cc32)OCCO4)c1 |
| InChI | InChI=1S/C23H30N2O3/c1-3-25(4-2)10-11-26-19-7-5-6-18(14-19)23-20-16-22-21(27-12-13-28-22)15-17(20)8-9-24-23/h5-7,14-16,23-24H,3-4,8-13H2,1-2H3 |
| InChIKey | HTKDZUZWCSAGEB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |