C23H31NO3 — CID 4008322
1-(3-butoxyphenyl)-6,7-diethoxy-1,2,3,4-tetrahydroisoquinoline (PubChem CID 4008322) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is 1-(3-butoxyphenyl)-6,7-diethoxy-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 1-(3-butoxyphenyl)-6,7-diethoxy-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 4008322 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | 1-(3-butoxyphenyl)-6,7-diethoxy-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CCCCOc1cccc(C2NCCc3cc(OCC)c(OCC)cc32)c1 |
| InChI | InChI=1S/C23H31NO3/c1-4-7-13-27-19-10-8-9-18(14-19)23-20-16-22(26-6-3)21(25-5-2)15-17(20)11-12-24-23/h8-10,14-16,23-24H,4-7,11-13H2,1-3H3 |
| InChIKey | ODOZVPBWZKTTDK-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|