C22H20ClNO3 — CID 5172171
1-[3-[(4-chlorophenyl)methoxy]phenyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol (PubChem CID 5172171) has the molecular formula C22H20ClNO3 and a molecular weight of 381.86 g/mol. Its IUPAC name is 1-[3-[(4-chlorophenyl)methoxy]phenyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol.
| Compound Name | 1-[3-[(4-chlorophenyl)methoxy]phenyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
|---|---|
| PubChem CID | 5172171 |
| Molecular Formula | C22H20ClNO3 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 1-[3-[(4-chlorophenyl)methoxy]phenyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
| SMILES | Oc1cc2c(cc1O)C(c1cccc(OCc3ccc(Cl)cc3)c1)NCC2 |
| InChI | InChI=1S/C22H20ClNO3/c23-17-6-4-14(5-7-17)13-27-18-3-1-2-16(10-18)22-19-12-21(26)20(25)11-15(19)8-9-24-22/h1-7,10-12,22,24-26H,8-9,13H2 |
| InChIKey | CLUSUNPEIZSHOE-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|