C19H20ClN3O — CID 110536407
3-[3-[(4-chlorophenyl)methoxy]phenyl]-3,3a,4,5,6,7-hexahydro-2H-pyrazolo[4,3-c]pyridine (PubChem CID 110536407) has the molecular formula C19H20ClN3O and a molecular weight of 341.84 g/mol. Its IUPAC name is 3-[3-[(4-chlorophenyl)methoxy]phenyl]-3,3a,4,5,6,7-hexahydro-2H-pyrazolo[4,3-c]pyridine.
| Compound Name | 3-[3-[(4-chlorophenyl)methoxy]phenyl]-3,3a,4,5,6,7-hexahydro-2H-pyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 110536407 |
| Molecular Formula | C19H20ClN3O |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 3-[3-[(4-chlorophenyl)methoxy]phenyl]-3,3a,4,5,6,7-hexahydro-2H-pyrazolo[4,3-c]pyridine |
| SMILES | Clc1ccc(COc2cccc(C3NN=C4CCNCC43)c2)cc1 |
| InChI | InChI=1S/C19H20ClN3O/c20-15-6-4-13(5-7-15)12-24-16-3-1-2-14(10-16)19-17-11-21-9-8-18(17)22-23-19/h1-7,10,17,19,21,23H,8-9,11-12H2 |
| InChIKey | NPRXXGUXFCACKI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |