C19H23ClN2 — CID 21484739
1-butyl-7-chloro-5-phenyl-2,3,4,5-tetrahydro-1,4-benzodiazepine (PubChem CID 21484739) has the molecular formula C19H23ClN2 and a molecular weight of 314.86 g/mol. Its IUPAC name is 1-butyl-7-chloro-5-phenyl-2,3,4,5-tetrahydro-1,4-benzodiazepine.
| Compound Name | 1-butyl-7-chloro-5-phenyl-2,3,4,5-tetrahydro-1,4-benzodiazepine |
|---|---|
| PubChem CID | 21484739 |
| Molecular Formula | C19H23ClN2 |
| Molecular Weight | 314.86 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 1-butyl-7-chloro-5-phenyl-2,3,4,5-tetrahydro-1,4-benzodiazepine |
| SMILES | CCCCN1CCNC(c2ccccc2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C19H23ClN2/c1-2-3-12-22-13-11-21-19(15-7-5-4-6-8-15)17-14-16(20)9-10-18(17)22/h4-10,14,19,21H,2-3,11-13H2,1H3 |
| InChIKey | LTNUVYLNHZVPIP-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.86 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |