C15H15ClN2 — CID 45043255
1-benzyl-5-chloro-2,3-dihydroindol-3-amine (PubChem CID 45043255) has the molecular formula C15H15ClN2 and a molecular weight of 258.75 g/mol. Its IUPAC name is 1-benzyl-5-chloro-2,3-dihydroindol-3-amine.
| Compound Name | 1-benzyl-5-chloro-2,3-dihydroindol-3-amine |
|---|---|
| PubChem CID | 45043255 |
| Molecular Formula | C15H15ClN2 |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 1-benzyl-5-chloro-2,3-dihydroindol-3-amine |
| SMILES | NC1CN(Cc2ccccc2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C15H15ClN2/c16-12-6-7-15-13(8-12)14(17)10-18(15)9-11-4-2-1-3-5-11/h1-8,14H,9-10,17H2 |
| InChIKey | APMIEMZYYXHPSY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |