C17H17ClN2O2 — CID 66757512
(1-benzyl-6-chloro-3,4-dihydro-2H-quinolin-3-yl)carbamic acid (PubChem CID 66757512) has the molecular formula C17H17ClN2O2 and a molecular weight of 316.79 g/mol. Its IUPAC name is (1-benzyl-6-chloro-3,4-dihydro-2H-quinolin-3-yl)carbamic acid.
| Compound Name | (1-benzyl-6-chloro-3,4-dihydro-2H-quinolin-3-yl)carbamic acid |
|---|---|
| PubChem CID | 66757512 |
| Molecular Formula | C17H17ClN2O2 |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | (1-benzyl-6-chloro-3,4-dihydro-2H-quinolin-3-yl)carbamic acid |
| SMILES | O=C(O)NC1Cc2cc(Cl)ccc2N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C17H17ClN2O2/c18-14-6-7-16-13(8-14)9-15(19-17(21)22)11-20(16)10-12-4-2-1-3-5-12/h1-8,15,19H,9-11H2,(H,21,22) |
| InChIKey | YYUUUGMJAZADST-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |