C25H29N3O — CID 58674918
N-(1-benzyl-6-isocyano-3,4-dihydro-2H-quinolin-3-yl)-2-cyclohexylacetamide (PubChem CID 58674918) has the molecular formula C25H29N3O and a molecular weight of 387.53 g/mol. Its IUPAC name is N-(1-benzyl-6-isocyano-3,4-dihydro-2H-quinolin-3-yl)-2-cyclohexylacetamide.
| Compound Name | N-(1-benzyl-6-isocyano-3,4-dihydro-2H-quinolin-3-yl)-2-cyclohexylacetamide |
|---|---|
| PubChem CID | 58674918 |
| Molecular Formula | C25H29N3O |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | N-(1-benzyl-6-isocyano-3,4-dihydro-2H-quinolin-3-yl)-2-cyclohexylacetamide |
| SMILES | [C-]#[N+]c1ccc2c(c1)CC(NC(=O)CC1CCCCC1)CN2Cc1ccccc1 |
| InChI | InChI=1S/C25H29N3O/c1-26-22-12-13-24-21(15-22)16-23(18-28(24)17-20-10-6-3-7-11-20)27-25(29)14-19-8-4-2-5-9-19/h3,6-7,10-13,15,19,23H,2,4-5,8-9,14,16-18H2,(H,27,29) |
| InChIKey | QFCQJWGYOKNKGQ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 36.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|