C26H27ClN2O2 — CID 68580973
N-(1-benzyl-6-chloro-3,4-dihydro-2H-quinolin-3-yl)-2-phenylmethoxypropanamide (PubChem CID 68580973) has the molecular formula C26H27ClN2O2 and a molecular weight of 434.97 g/mol. Its IUPAC name is N-(1-benzyl-6-chloro-3,4-dihydro-2H-quinolin-3-yl)-2-phenylmethoxypropanamide.
| Compound Name | N-(1-benzyl-6-chloro-3,4-dihydro-2H-quinolin-3-yl)-2-phenylmethoxypropanamide |
|---|---|
| PubChem CID | 68580973 |
| Molecular Formula | C26H27ClN2O2 |
| Molecular Weight | 434.97 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | N-(1-benzyl-6-chloro-3,4-dihydro-2H-quinolin-3-yl)-2-phenylmethoxypropanamide |
| SMILES | CC(OCc1ccccc1)C(=O)NC1Cc2cc(Cl)ccc2N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C26H27ClN2O2/c1-19(31-18-21-10-6-3-7-11-21)26(30)28-24-15-22-14-23(27)12-13-25(22)29(17-24)16-20-8-4-2-5-9-20/h2-14,19,24H,15-18H2,1H3,(H,28,30) |
| InChIKey | YBNICHHAVZLLCM-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.97 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |