C25H22ClN3O — CID 58674919
N-[1-[(3-chlorophenyl)methyl]-6-isocyano-3,4-dihydro-2H-quinolin-3-yl]-2-phenylacetamide (PubChem CID 58674919) has the molecular formula C25H22ClN3O and a molecular weight of 415.92 g/mol. Its IUPAC name is N-[1-[(3-chlorophenyl)methyl]-6-isocyano-3,4-dihydro-2H-quinolin-3-yl]-2-phenylacetamide.
| Compound Name | N-[1-[(3-chlorophenyl)methyl]-6-isocyano-3,4-dihydro-2H-quinolin-3-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 58674919 |
| Molecular Formula | C25H22ClN3O |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | N-[1-[(3-chlorophenyl)methyl]-6-isocyano-3,4-dihydro-2H-quinolin-3-yl]-2-phenylacetamide |
| SMILES | [C-]#[N+]c1ccc2c(c1)CC(NC(=O)Cc1ccccc1)CN2Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C25H22ClN3O/c1-27-22-10-11-24-20(14-22)15-23(28-25(30)13-18-6-3-2-4-7-18)17-29(24)16-19-8-5-9-21(26)12-19/h2-12,14,23H,13,15-17H2,(H,28,30) |
| InChIKey | QHSJRFZGJDOQCB-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 36.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|