C20H19ClN2O2S2 — CID 11350637
N-(1-benzyl-6-chloro-3,4-dihydro-2H-quinolin-3-yl)thiophene-3-sulfonamide (PubChem CID 11350637) has the molecular formula C20H19ClN2O2S2 and a molecular weight of 418.97 g/mol. Its IUPAC name is N-(1-benzyl-6-chloro-3,4-dihydro-2H-quinolin-3-yl)thiophene-3-sulfonamide.
| Compound Name | N-(1-benzyl-6-chloro-3,4-dihydro-2H-quinolin-3-yl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 11350637 |
| Molecular Formula | C20H19ClN2O2S2 |
| Molecular Weight | 418.97 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | N-(1-benzyl-6-chloro-3,4-dihydro-2H-quinolin-3-yl)thiophene-3-sulfonamide |
| SMILES | O=S(=O)(NC1Cc2cc(Cl)ccc2N(Cc2ccccc2)C1)c1ccsc1 |
| InChI | InChI=1S/C20H19ClN2O2S2/c21-17-6-7-20-16(10-17)11-18(22-27(24,25)19-8-9-26-14-19)13-23(20)12-15-4-2-1-3-5-15/h1-10,14,18,22H,11-13H2 |
| InChIKey | OXVFHXNEMCZNBT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.97 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |