C16H14ClNO3 — CID 59367840
4-benzyl-6-chloro-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid (PubChem CID 59367840) has the molecular formula C16H14ClNO3 and a molecular weight of 303.75 g/mol. Its IUPAC name is 4-benzyl-6-chloro-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid.
| Compound Name | 4-benzyl-6-chloro-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid |
|---|---|
| PubChem CID | 59367840 |
| Molecular Formula | C16H14ClNO3 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 4-benzyl-6-chloro-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid |
| SMILES | O=C(O)C1CN(Cc2ccccc2)c2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C16H14ClNO3/c17-12-6-7-14-13(8-12)18(10-15(21-14)16(19)20)9-11-4-2-1-3-5-11/h1-8,15H,9-10H2,(H,19,20) |
| InChIKey | SCFBFGRRFAQTOI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |