C13H17ClN2 — CID 45043254
5-chloro-1-cyclopentyl-2,3-dihydroindol-3-amine (PubChem CID 45043254) has the molecular formula C13H17ClN2 and a molecular weight of 236.75 g/mol. Its IUPAC name is 5-chloro-1-cyclopentyl-2,3-dihydroindol-3-amine.
| Compound Name | 5-chloro-1-cyclopentyl-2,3-dihydroindol-3-amine |
|---|---|
| PubChem CID | 45043254 |
| Molecular Formula | C13H17ClN2 |
| Molecular Weight | 236.75 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 5-chloro-1-cyclopentyl-2,3-dihydroindol-3-amine |
| SMILES | NC1CN(C2CCCC2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C13H17ClN2/c14-9-5-6-13-11(7-9)12(15)8-16(13)10-3-1-2-4-10/h5-7,10,12H,1-4,8,15H2 |
| InChIKey | YSIXEKFGVZQADM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.75 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |