About 6-chloro-2-methyl-2-(4-methylphenyl)-4-phenyl-3,4-dihydro-1H-quinazoline
6-chloro-2-methyl-2-(4-methylphenyl)-4-phenyl-3,4-dihydro-1H-quinazoline (PubChem CID 15566234) has the molecular formula C22H21ClN2
and a molecular weight of 348.88 g/mol. Its IUPAC name is 6-chloro-2-methyl-2-(4-methylphenyl)-4-phenyl-3,4-dihydro-1H-quinazoline.
Molecular Properties
| Compound Name | 6-chloro-2-methyl-2-(4-methylphenyl)-4-phenyl-3,4-dihydro-1H-quinazoline |
| PubChem CID | 15566234 |
| Molecular Formula | C22H21ClN2 |
| Molecular Weight | 348.88 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 6-chloro-2-methyl-2-(4-methylphenyl)-4-phenyl-3,4-dihydro-1H-quinazoline |
| SMILES | Cc1ccc(C2(C)Nc3ccc(Cl)cc3C(c3ccccc3)N2)cc1 |
| InChI | InChI=1S/C22H21ClN2/c1-15-8-10-17(11-9-15)22(2)24-20-13-12-18(23)14-19(20)21(25-22)16-6-4-3-5-7-16/h3-14,21,24-25H,1-2H3 |
| InChIKey | AKMQFHMUTHMCMS-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.88 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-chloro-2-methyl-2-(4-methylphenyl)-4-phenyl-3,4-dihydro-1H-quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-methyl-2-(4-methylphenyl)-4-phenyl-3,4-dihydro-1H-quinazoline?
The IUPAC name of 6-chloro-2-methyl-2-(4-methylphenyl)-4-phenyl-3,4-dihydro-1H-quinazoline (CID 15566234) is 6-chloro-2-methyl-2-(4-methylphenyl)-4-phenyl-3,4-dihydro-1H-quinazoline.
What is the SMILES notation for 6-chloro-2-methyl-2-(4-methylphenyl)-4-phenyl-3,4-dihydro-1H-quinazoline?
The canonical SMILES for 6-chloro-2-methyl-2-(4-methylphenyl)-4-phenyl-3,4-dihydro-1H-quinazoline is Cc1ccc(C2(C)Nc3ccc(Cl)cc3C(c3ccccc3)N2)cc1.
What is the InChIKey of 6-chloro-2-methyl-2-(4-methylphenyl)-4-phenyl-3,4-dihydro-1H-quinazoline?
The InChIKey is AKMQFHMUTHMCMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21ClN2/c1-15-8-10-17(11-9-15)22(2)24-20-13-12-18(23)14-19(20)21(25-22)16-6-4-3-5-7-16/h3-14,21,24-25H,1-2H3.
What are the key properties of 6-chloro-2-methyl-2-(4-methylphenyl)-4-phenyl-3,4-dihydro-1H-quinazoline?
6-chloro-2-methyl-2-(4-methylphenyl)-4-phenyl-3,4-dihydro-1H-quinazoline has a molecular weight of 348.88 g/mol, XLogP of 5.63, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-methyl-2-(4-methylphenyl)-4-phenyl-3,4-dihydro-1H-quinazoline is sourced from PubChem (CID 15566234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).