C16H16ClN — CID 125481104
(3S)-8-chloro-3-phenyl-2,3,4,5-tetrahydro-1H-1-benzazepine (PubChem CID 125481104) has the molecular formula C16H16ClN and a molecular weight of 257.76 g/mol. Its IUPAC name is (3S)-8-chloro-3-phenyl-2,3,4,5-tetrahydro-1H-1-benzazepine.
| Compound Name | (3S)-8-chloro-3-phenyl-2,3,4,5-tetrahydro-1H-1-benzazepine |
|---|---|
| PubChem CID | 125481104 |
| Molecular Formula | C16H16ClN |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | (3S)-8-chloro-3-phenyl-2,3,4,5-tetrahydro-1H-1-benzazepine |
| SMILES | Clc1ccc2c(c1)NC[C@H](c1ccccc1)CC2 |
| InChI | InChI=1S/C16H16ClN/c17-15-9-8-13-6-7-14(11-18-16(13)10-15)12-4-2-1-3-5-12/h1-5,8-10,14,18H,6-7,11H2/t14-/m1/s1 |
| InChIKey | XUSLXSQVHRCJEU-CQSZACIVSA-N |
| XLogP | 4.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |