C25H20Cl2N2O2 — CID 91616341
6-chloro-4'-(3-chlorophenyl)-6'-phenylspiro[1H-indole-3,5'-azepane]-2,2'-dione (PubChem CID 91616341) has the molecular formula C25H20Cl2N2O2 and a molecular weight of 451.35 g/mol. Its IUPAC name is 6-chloro-4'-(3-chlorophenyl)-6'-phenylspiro[1H-indole-3,5'-azepane]-2,2'-dione.
| Compound Name | 6-chloro-4'-(3-chlorophenyl)-6'-phenylspiro[1H-indole-3,5'-azepane]-2,2'-dione |
|---|---|
| PubChem CID | 91616341 |
| Molecular Formula | C25H20Cl2N2O2 |
| Molecular Weight | 451.35 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | 6-chloro-4'-(3-chlorophenyl)-6'-phenylspiro[1H-indole-3,5'-azepane]-2,2'-dione |
| SMILES | O=C1CC(c2cccc(Cl)c2)C2(C(=O)Nc3cc(Cl)ccc32)C(c2ccccc2)CN1 |
| InChI | InChI=1S/C25H20Cl2N2O2/c26-17-8-4-7-16(11-17)20-13-23(30)28-14-21(15-5-2-1-3-6-15)25(20)19-10-9-18(27)12-22(19)29-24(25)31/h1-12,20-21H,13-14H2,(H,28,30)(H,29,31) |
| InChIKey | MSSRHXCQRYLESY-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.35 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |