C9H9NOS — CID 141177403
1-sulfanyl-2,4-dihydro-1H-isoquinolin-3-one (PubChem CID 141177403) has the molecular formula C9H9NOS and a molecular weight of 179.24 g/mol. Its IUPAC name is 1-sulfanyl-2,4-dihydro-1H-isoquinolin-3-one.
| Compound Name | 1-sulfanyl-2,4-dihydro-1H-isoquinolin-3-one |
|---|---|
| PubChem CID | 141177403 |
| Molecular Formula | C9H9NOS |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | 1-sulfanyl-2,4-dihydro-1H-isoquinolin-3-one |
| SMILES | O=C1Cc2ccccc2C(S)N1 |
| InChI | InChI=1S/C9H9NOS/c11-8-5-6-3-1-2-4-7(6)9(12)10-8/h1-4,9,12H,5H2,(H,10,11) |
| InChIKey | FTNKPIFHDROCHV-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|