C15H15N — CID 59778295
6-methyl-6,11-dihydro-5H-benzo[c][1]benzazepine (PubChem CID 59778295) has the molecular formula C15H15N and a molecular weight of 209.29 g/mol. Its IUPAC name is 6-methyl-6,11-dihydro-5H-benzo[c][1]benzazepine.
| Compound Name | 6-methyl-6,11-dihydro-5H-benzo[c][1]benzazepine |
|---|---|
| PubChem CID | 59778295 |
| Molecular Formula | C15H15N |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 6-methyl-6,11-dihydro-5H-benzo[c][1]benzazepine |
| SMILES | CC1Nc2ccccc2Cc2ccccc21 |
| InChI | InChI=1S/C15H15N/c1-11-14-8-4-2-6-12(14)10-13-7-3-5-9-15(13)16-11/h2-9,11,16H,10H2,1H3 |
| InChIKey | KSRYANBCYLTKOB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |