About (2R)-2-methyl-2,3-dihydro-1H-indole;hydrochloride
(2R)-2-methyl-2,3-dihydro-1H-indole;hydrochloride (PubChem CID 155819591) has the molecular formula C9H12ClN
and a molecular weight of 169.66 g/mol. Its IUPAC name is (2R)-2-methyl-2,3-dihydro-1H-indole;hydrochloride.
Molecular Properties
| Compound Name | (2R)-2-methyl-2,3-dihydro-1H-indole;hydrochloride |
| PubChem CID | 155819591 |
| Molecular Formula | C9H12ClN |
| Molecular Weight | 169.66 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | (2R)-2-methyl-2,3-dihydro-1H-indole;hydrochloride |
| SMILES | C[C@@H]1Cc2ccccc2N1.Cl |
| InChI | InChI=1S/C9H11N.ClH/c1-7-6-8-4-2-3-5-9(8)10-7;/h2-5,7,10H,6H2,1H3;1H/t7-;/m1./s1 |
| InChIKey | GFRLXAIQCOSMAN-OGFXRTJISA-N |
| XLogP | 2.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.66 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R)-2-methyl-2,3-dihydro-1H-indole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-methyl-2,3-dihydro-1H-indole;hydrochloride?
The IUPAC name of (2R)-2-methyl-2,3-dihydro-1H-indole;hydrochloride (CID 155819591) is (2R)-2-methyl-2,3-dihydro-1H-indole;hydrochloride.
What is the SMILES notation for (2R)-2-methyl-2,3-dihydro-1H-indole;hydrochloride?
The canonical SMILES for (2R)-2-methyl-2,3-dihydro-1H-indole;hydrochloride is C[C@@H]1Cc2ccccc2N1.Cl.
What is the InChIKey of (2R)-2-methyl-2,3-dihydro-1H-indole;hydrochloride?
The InChIKey is GFRLXAIQCOSMAN-OGFXRTJISA-N. The full InChI is InChI=1S/C9H11N.ClH/c1-7-6-8-4-2-3-5-9(8)10-7;/h2-5,7,10H,6H2,1H3;1H/t7-;/m1./s1.
What are the key properties of (2R)-2-methyl-2,3-dihydro-1H-indole;hydrochloride?
(2R)-2-methyl-2,3-dihydro-1H-indole;hydrochloride has a molecular weight of 169.66 g/mol, XLogP of 2.46, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-methyl-2,3-dihydro-1H-indole;hydrochloride is sourced from PubChem (CID 155819591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).