C10H13NTi — CID 158265975
2-methyl-1,2,3,4-tetrahydroquinoline;titanium (PubChem CID 158265975) has the molecular formula C10H13NTi and a molecular weight of 195.09 g/mol. Its IUPAC name is 2-methyl-1,2,3,4-tetrahydroquinoline;titanium.
| Compound Name | 2-methyl-1,2,3,4-tetrahydroquinoline;titanium |
|---|---|
| PubChem CID | 158265975 |
| Molecular Formula | C10H13NTi |
| Molecular Weight | 195.09 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 2-methyl-1,2,3,4-tetrahydroquinoline;titanium |
| SMILES | CC1CCc2ccccc2N1.[Ti] |
| InChI | InChI=1S/C10H13N.Ti/c1-8-6-7-9-4-2-3-5-10(9)11-8;/h2-5,8,11H,6-7H2,1H3; |
| InChIKey | GILDOAFDQQQPQL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.09 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |