C11H14ClNO2 — CID 142459646
2-chloro-1,2,3,4-tetrahydroquinoline;methyl formate (PubChem CID 142459646) has the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. Its IUPAC name is 2-chloro-1,2,3,4-tetrahydroquinoline;methyl formate.
| Compound Name | 2-chloro-1,2,3,4-tetrahydroquinoline;methyl formate |
|---|---|
| PubChem CID | 142459646 |
| Molecular Formula | C11H14ClNO2 |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 2-chloro-1,2,3,4-tetrahydroquinoline;methyl formate |
| SMILES | COC=O.ClC1CCc2ccccc2N1 |
| InChI | InChI=1S/C9H10ClN.C2H4O2/c10-9-6-5-7-3-1-2-4-8(7)11-9;1-4-2-3/h1-4,9,11H,5-6H2;2H,1H3 |
| InChIKey | RUWSTAZGFFUFGN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|