C11H12N2 — CID 10464768
2-[(2S)-1,2,3,4-tetrahydroquinolin-2-yl]acetonitrile (PubChem CID 10464768) has the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 2-[(2S)-1,2,3,4-tetrahydroquinolin-2-yl]acetonitrile.
| Compound Name | 2-[(2S)-1,2,3,4-tetrahydroquinolin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 10464768 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 2-[(2S)-1,2,3,4-tetrahydroquinolin-2-yl]acetonitrile |
| SMILES | N#CC[C@@H]1CCc2ccccc2N1 |
| InChI | InChI=1S/C11H12N2/c12-8-7-10-6-5-9-3-1-2-4-11(9)13-10/h1-4,10,13H,5-7H2/t10-/m0/s1 |
| InChIKey | QZTBXCDPHAWCOL-JTQLQIEISA-N |
| XLogP | 2.33 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |