C14H21N — CID 15606332
(2S)-2-pentyl-1,2,3,4-tetrahydroquinoline (PubChem CID 15606332) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is (2S)-2-pentyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | (2S)-2-pentyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 15606332 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | (2S)-2-pentyl-1,2,3,4-tetrahydroquinoline |
| SMILES | CCCCC[C@H]1CCc2ccccc2N1 |
| InChI | InChI=1S/C14H21N/c1-2-3-4-8-13-11-10-12-7-5-6-9-14(12)15-13/h5-7,9,13,15H,2-4,8,10-11H2,1H3/t13-/m0/s1 |
| InChIKey | COWWTNSCQZQEAB-ZDUSSCGKSA-N |
| XLogP | 3.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|