C16H25N — CID 106778414
2-hexyl-3-methyl-1,2,3,4-tetrahydroquinoline (PubChem CID 106778414) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is 2-hexyl-3-methyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 2-hexyl-3-methyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 106778414 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | 2-hexyl-3-methyl-1,2,3,4-tetrahydroquinoline |
| SMILES | CCCCCCC1Nc2ccccc2CC1C |
| InChI | InChI=1S/C16H25N/c1-3-4-5-6-10-15-13(2)12-14-9-7-8-11-16(14)17-15/h7-9,11,13,15,17H,3-6,10,12H2,1-2H3 |
| InChIKey | HGRGZWIGVVTYLI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|